C29H27NO6 — CID 11837756
[2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxylate (PubChem CID 11837756) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxylate.
| Compound Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11837756 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | [2-[4-(4-methylbenzoyl)oxyphenyl]-2-oxoethyl] 5-oxo-1-(1-phenylethyl)pyrrolidine-3-carboxylate |
| SMILES | Cc1ccc(C(=O)Oc2ccc(C(=O)COC(=O)C3CC(=O)N(C(C)c4ccccc4)C3)cc2)cc1 |
| InChI | InChI=1S/C29H27NO6/c1-19-8-10-23(11-9-19)29(34)36-25-14-12-22(13-15-25)26(31)18-35-28(33)24-16-27(32)30(17-24)20(2)21-6-4-3-5-7-21/h3-15,20,24H,16-18H2,1-2H3 |
| InChIKey | LLPBUJBKYMRWQP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|