C21H23NO3 — CID 9057026
(3,5-dimethylphenyl) (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate (PubChem CID 9057026) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is (3,5-dimethylphenyl) (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate.
| Compound Name | (3,5-dimethylphenyl) (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057026 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | (3,5-dimethylphenyl) (3S)-5-oxo-1-[(1S)-1-phenylethyl]pyrrolidine-3-carboxylate |
| SMILES | Cc1cc(C)cc(OC(=O)[C@H]2CC(=O)N([C@@H](C)c3ccccc3)C2)c1 |
| InChI | InChI=1S/C21H23NO3/c1-14-9-15(2)11-19(10-14)25-21(24)18-12-20(23)22(13-18)16(3)17-7-5-4-6-8-17/h4-11,16,18H,12-13H2,1-3H3/t16-,18-/m0/s1 |
| InChIKey | HNWIJQHROPSESX-WMZOPIPTSA-N |
| XLogP | 3.82 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|