C28H29NO3 — CID 9057010
[4-(2-phenylpropan-2-yl)phenyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate (PubChem CID 9057010) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is [4-(2-phenylpropan-2-yl)phenyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate.
| Compound Name | [4-(2-phenylpropan-2-yl)phenyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 9057010 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | [4-(2-phenylpropan-2-yl)phenyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1C[C@H](C(=O)Oc2ccc(C(C)(C)c3ccccc3)cc2)CC1=O |
| InChI | InChI=1S/C28H29NO3/c1-20(21-10-6-4-7-11-21)29-19-22(18-26(29)30)27(31)32-25-16-14-24(15-17-25)28(2,3)23-12-8-5-9-13-23/h4-17,20,22H,18-19H2,1-3H3/t20-,22-/m1/s1 |
| InChIKey | OUYPUGHXPWTLJL-IFMALSPDSA-N |
| XLogP | 5.53 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|