C28H25NO6 — CID 40875981
[2-(4-benzoyloxyphenyl)-2-oxoethyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate (PubChem CID 40875981) has the molecular formula C28H25NO6 and a molecular weight of 471.51 g/mol. Its IUPAC name is [2-(4-benzoyloxyphenyl)-2-oxoethyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate.
| Compound Name | [2-(4-benzoyloxyphenyl)-2-oxoethyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 40875981 |
| Molecular Formula | C28H25NO6 |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.17 |
| IUPAC Name | [2-(4-benzoyloxyphenyl)-2-oxoethyl] (3R)-5-oxo-1-[(1R)-1-phenylethyl]pyrrolidine-3-carboxylate |
| SMILES | C[C@H](c1ccccc1)N1C[C@H](C(=O)OCC(=O)c2ccc(OC(=O)c3ccccc3)cc2)CC1=O |
| InChI | InChI=1S/C28H25NO6/c1-19(20-8-4-2-5-9-20)29-17-23(16-26(29)31)27(32)34-18-25(30)21-12-14-24(15-13-21)35-28(33)22-10-6-3-7-11-22/h2-15,19,23H,16-18H2,1H3/t19-,23-/m1/s1 |
| InChIKey | TVTJTZFMMNJAMN-AUSIDOKSSA-N |
| XLogP | 4.24 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|