C20H31NO2 — CID 118377657
(2E,4E)-dodeca-2,4-diene;2-(4-hydroxyphenyl)acetamide (PubChem CID 118377657) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (2E,4E)-dodeca-2,4-diene;2-(4-hydroxyphenyl)acetamide.
| Compound Name | (2E,4E)-dodeca-2,4-diene;2-(4-hydroxyphenyl)acetamide |
|---|---|
| PubChem CID | 118377657 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (2E,4E)-dodeca-2,4-diene;2-(4-hydroxyphenyl)acetamide |
| SMILES | C/C=C/C=C/CCCCCCC.NC(=O)Cc1ccc(O)cc1 |
| InChI | InChI=1S/C12H22.C8H9NO2/c1-3-5-7-9-11-12-10-8-6-4-2;9-8(11)5-6-1-3-7(10)4-2-6/h3,5,7,9H,4,6,8,10-12H2,1-2H3;1-4,10H,5H2,(H2,9,11)/b5-3+,9-7+; |
| InChIKey | NZCUKGIXBQNJTH-VSSJHNHUSA-N |
| XLogP | 4.90 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|