C25H21NO6S — CID 11837820
[2-oxo-2-[4-(thiophene-2-carbonyloxy)phenyl]ethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate (PubChem CID 11837820) has the molecular formula C25H21NO6S and a molecular weight of 463.51 g/mol. Its IUPAC name is [2-oxo-2-[4-(thiophene-2-carbonyloxy)phenyl]ethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate.
| Compound Name | [2-oxo-2-[4-(thiophene-2-carbonyloxy)phenyl]ethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 11837820 |
| Molecular Formula | C25H21NO6S |
| Molecular Weight | 463.51 g/mol |
| Exact Mass | 463.11 |
| IUPAC Name | [2-oxo-2-[4-(thiophene-2-carbonyloxy)phenyl]ethyl] 1-benzyl-5-oxopyrrolidine-3-carboxylate |
| SMILES | O=C(COC(=O)C1CC(=O)N(Cc2ccccc2)C1)c1ccc(OC(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C25H21NO6S/c27-21(18-8-10-20(11-9-18)32-25(30)22-7-4-12-33-22)16-31-24(29)19-13-23(28)26(15-19)14-17-5-2-1-3-6-17/h1-12,19H,13-16H2 |
| InChIKey | SHMXNEITAYAODU-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|