C23H19FN4O5S — CID 118386337
[2-[2-amino-5-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]anilino]-2-oxoethyl]carbamic acid (PubChem CID 118386337) has the molecular formula C23H19FN4O5S and a molecular weight of 482.49 g/mol. Its IUPAC name is [2-[2-amino-5-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]anilino]-2-oxoethyl]carbamic acid.
| Compound Name | [2-[2-amino-5-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]anilino]-2-oxoethyl]carbamic acid |
|---|---|
| PubChem CID | 118386337 |
| Molecular Formula | C23H19FN4O5S |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.11 |
| IUPAC Name | [2-[2-amino-5-[1-(benzenesulfonyl)-6-fluoroindol-3-yl]anilino]-2-oxoethyl]carbamic acid |
| SMILES | Nc1ccc(-c2cn(S(=O)(=O)c3ccccc3)c3cc(F)ccc23)cc1NC(=O)CNC(=O)O |
| InChI | InChI=1S/C23H19FN4O5S/c24-15-7-8-17-18(13-28(21(17)11-15)34(32,33)16-4-2-1-3-5-16)14-6-9-19(25)20(10-14)27-22(29)12-26-23(30)31/h1-11,13,26H,12,25H2,(H,27,29)(H,30,31) |
| InChIKey | BBZCQJFZDAQLBF-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 143.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|