C22H26ClNO3 — CID 118387294
tert-butyl 1-(5-chloro-2-hydroxyphenyl)-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate (PubChem CID 118387294) has the molecular formula C22H26ClNO3 and a molecular weight of 387.91 g/mol. Its IUPAC name is tert-butyl 1-(5-chloro-2-hydroxyphenyl)-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate.
| Compound Name | tert-butyl 1-(5-chloro-2-hydroxyphenyl)-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 118387294 |
| Molecular Formula | C22H26ClNO3 |
| Molecular Weight | 387.91 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | tert-butyl 1-(5-chloro-2-hydroxyphenyl)-4,4-dimethyl-1,3-dihydroisoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CC(C)(C)c2ccccc2C1c1cc(Cl)ccc1O |
| InChI | InChI=1S/C22H26ClNO3/c1-21(2,3)27-20(26)24-13-22(4,5)17-9-7-6-8-15(17)19(24)16-12-14(23)10-11-18(16)25/h6-12,19,25H,13H2,1-5H3 |
| InChIKey | JXLWUHHWEBYJKS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.91 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|