C11H20O — CID 118389184
(3R)-3-ethyl-3,6-dimethylhept-5-en-2-one (PubChem CID 118389184) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is (3R)-3-ethyl-3,6-dimethylhept-5-en-2-one.
| Compound Name | (3R)-3-ethyl-3,6-dimethylhept-5-en-2-one |
|---|---|
| PubChem CID | 118389184 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | (3R)-3-ethyl-3,6-dimethylhept-5-en-2-one |
| SMILES | CC[C@](C)(CC=C(C)C)C(C)=O |
| InChI | InChI=1S/C11H20O/c1-6-11(5,10(4)12)8-7-9(2)3/h7H,6,8H2,1-5H3/t11-/m1/s1 |
| InChIKey | JLLMDRBGHDAQBS-LLVKDONJSA-N |
| XLogP | 3.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|