C12H20O — CID 59467315
3-ethyl-3,6-dimethyl-5-methylidenehept-6-en-2-one (PubChem CID 59467315) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is 3-ethyl-3,6-dimethyl-5-methylidenehept-6-en-2-one.
| Compound Name | 3-ethyl-3,6-dimethyl-5-methylidenehept-6-en-2-one |
|---|---|
| PubChem CID | 59467315 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | 3-ethyl-3,6-dimethyl-5-methylidenehept-6-en-2-one |
| SMILES | C=C(C)C(=C)CC(C)(CC)C(C)=O |
| InChI | InChI=1S/C12H20O/c1-7-12(6,11(5)13)8-10(4)9(2)3/h2,4,7-8H2,1,3,5-6H3 |
| InChIKey | CRYKJCUPLMNCCE-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|