About 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene
3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene (PubChem CID 143468476) has the molecular formula C20H38O
and a molecular weight of 294.52 g/mol. Its IUPAC name is 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene.
Molecular Properties
| Compound Name | 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene |
| PubChem CID | 143468476 |
| Molecular Formula | C20H38O |
| Molecular Weight | 294.52 g/mol |
| Exact Mass | 294.29 |
| IUPAC Name | 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene |
| SMILES | C=C(C)C.CC12CCC(CC1)C2.CCC(C)(CC)C(C)=O |
| InChI | InChI=1S/C8H16O.C8H14.C4H8/c1-5-8(4,6-2)7(3)9;1-8-4-2-7(6-8)3-5-8;1-4(2)3/h5-6H2,1-4H3;7H,2-6H2,1H3;1H2,2-3H3 |
| InChIKey | NWPPCBDJXWIQNS-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene?
The IUPAC name of 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene (CID 143468476) is 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene.
What is the SMILES notation for 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene?
The canonical SMILES for 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene is C=C(C)C.CC12CCC(CC1)C2.CCC(C)(CC)C(C)=O.
What is the InChIKey of 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene?
The InChIKey is NWPPCBDJXWIQNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O.C8H14.C4H8/c1-5-8(4,6-2)7(3)9;1-8-4-2-7(6-8)3-5-8;1-4(2)3/h5-6H2,1-4H3;7H,2-6H2,1H3;1H2,2-3H3.
What are the key properties of 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene?
3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene has a molecular weight of 294.52 g/mol, XLogP of 6.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-3-methylpentan-2-one;1-methylbicyclo[2.2.1]heptane;2-methylprop-1-ene is sourced from PubChem (CID 143468476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).