C20H30O4 — CID 118389519
4-ethyl-2-hydroxy-7-[4-(2-hydroxy-2-methylpropanoyl)phenyl]-2-methylheptan-3-one (PubChem CID 118389519) has the molecular formula C20H30O4 and a molecular weight of 334.46 g/mol. Its IUPAC name is 4-ethyl-2-hydroxy-7-[4-(2-hydroxy-2-methylpropanoyl)phenyl]-2-methylheptan-3-one.
| Compound Name | 4-ethyl-2-hydroxy-7-[4-(2-hydroxy-2-methylpropanoyl)phenyl]-2-methylheptan-3-one |
|---|---|
| PubChem CID | 118389519 |
| Molecular Formula | C20H30O4 |
| Molecular Weight | 334.46 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | 4-ethyl-2-hydroxy-7-[4-(2-hydroxy-2-methylpropanoyl)phenyl]-2-methylheptan-3-one |
| SMILES | CCC(CCCc1ccc(C(=O)C(C)(C)O)cc1)C(=O)C(C)(C)O |
| InChI | InChI=1S/C20H30O4/c1-6-15(17(21)19(2,3)23)9-7-8-14-10-12-16(13-11-14)18(22)20(4,5)24/h10-13,15,23-24H,6-9H2,1-5H3 |
| InChIKey | KDJXFKLNPVDIAP-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |