About 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole
2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole (PubChem CID 118391801) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole.
Molecular Properties
| Compound Name | 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole |
| PubChem CID | 118391801 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole |
| SMILES | CC(C)(C)Cc1cnc(C(C)(C)C)o1 |
| InChI | InChI=1S/C12H21NO/c1-11(2,3)7-9-8-13-10(14-9)12(4,5)6/h8H,7H2,1-6H3 |
| InChIKey | UKVWVEICYWNISP-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole?
The IUPAC name of 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole (CID 118391801) is 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole.
What is the SMILES notation for 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole?
The canonical SMILES for 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole is CC(C)(C)Cc1cnc(C(C)(C)C)o1.
What is the InChIKey of 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole?
The InChIKey is UKVWVEICYWNISP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21NO/c1-11(2,3)7-9-8-13-10(14-9)12(4,5)6/h8H,7H2,1-6H3.
What are the key properties of 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole?
2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole has a molecular weight of 195.31 g/mol, XLogP of 3.56, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-tert-butyl-5-(2,2-dimethylpropyl)-1,3-oxazole is sourced from PubChem (CID 118391801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).