C16H27N3O5 — CID 102289136
propan-2-yl N-[(2-tert-butyl-1,3-oxazol-5-yl)methyl]-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 102289136) has the molecular formula C16H27N3O5 and a molecular weight of 341.41 g/mol. Its IUPAC name is propan-2-yl N-[(2-tert-butyl-1,3-oxazol-5-yl)methyl]-N-(propan-2-yloxycarbonylamino)carbamate.
| Compound Name | propan-2-yl N-[(2-tert-butyl-1,3-oxazol-5-yl)methyl]-N-(propan-2-yloxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102289136 |
| Molecular Formula | C16H27N3O5 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | propan-2-yl N-[(2-tert-butyl-1,3-oxazol-5-yl)methyl]-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | CC(C)OC(=O)NN(Cc1cnc(C(C)(C)C)o1)C(=O)OC(C)C |
| InChI | InChI=1S/C16H27N3O5/c1-10(2)22-14(20)18-19(15(21)23-11(3)4)9-12-8-17-13(24-12)16(5,6)7/h8,10-11H,9H2,1-7H3,(H,18,20) |
| InChIKey | JCDZCSHEAWTJPQ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|