C13H26N2O5 — CID 102043449
propan-2-yl N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 102043449) has the molecular formula C13H26N2O5 and a molecular weight of 290.36 g/mol. Its IUPAC name is propan-2-yl N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate.
| Compound Name | propan-2-yl N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 102043449 |
| Molecular Formula | C13H26N2O5 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | propan-2-yl N-[(2S)-1-hydroxy-3-methylbutan-2-yl]-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | CC(C)OC(=O)NN(C(=O)OC(C)C)[C@H](CO)C(C)C |
| InChI | InChI=1S/C13H26N2O5/c1-8(2)11(7-16)15(13(18)20-10(5)6)14-12(17)19-9(3)4/h8-11,16H,7H2,1-6H3,(H,14,17)/t11-/m1/s1 |
| InChIKey | GDSVHGDVUGCDKZ-LLVKDONJSA-N |
| XLogP | 1.90 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|