C10H20N2O4S2 — CID 174359347
propan-2-yl N-[[hydroxy(propan-2-yloxy)methyl]-methylsulfanylcarbothioylamino]carbamate (PubChem CID 174359347) has the molecular formula C10H20N2O4S2 and a molecular weight of 296.41 g/mol. Its IUPAC name is propan-2-yl N-[[hydroxy(propan-2-yloxy)methyl]-methylsulfanylcarbothioylamino]carbamate.
| Compound Name | propan-2-yl N-[[hydroxy(propan-2-yloxy)methyl]-methylsulfanylcarbothioylamino]carbamate |
|---|---|
| PubChem CID | 174359347 |
| Molecular Formula | C10H20N2O4S2 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | propan-2-yl N-[[hydroxy(propan-2-yloxy)methyl]-methylsulfanylcarbothioylamino]carbamate |
| SMILES | CSC(=S)N(NC(=O)OC(C)C)C(O)OC(C)C |
| InChI | InChI=1S/C10H20N2O4S2/c1-6(2)15-8(13)11-12(10(17)18-5)9(14)16-7(3)4/h6-7,9,14H,1-5H3,(H,11,13) |
| InChIKey | WBRAYHLKDRSDMW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 71.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|