C20H36N2O4 — CID 90880553
propan-2-yl N-[(8R)-8-ethyldeca-4,9-dien-3-yl]-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 90880553) has the molecular formula C20H36N2O4 and a molecular weight of 368.52 g/mol. Its IUPAC name is propan-2-yl N-[(8R)-8-ethyldeca-4,9-dien-3-yl]-N-(propan-2-yloxycarbonylamino)carbamate.
| Compound Name | propan-2-yl N-[(8R)-8-ethyldeca-4,9-dien-3-yl]-N-(propan-2-yloxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 90880553 |
| Molecular Formula | C20H36N2O4 |
| Molecular Weight | 368.52 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | propan-2-yl N-[(8R)-8-ethyldeca-4,9-dien-3-yl]-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | C=CC(CC)CCC=CC(CC)N(NC(=O)OC(C)C)C(=O)OC(C)C |
| InChI | InChI=1S/C20H36N2O4/c1-8-17(9-2)13-11-12-14-18(10-3)22(20(24)26-16(6)7)21-19(23)25-15(4)5/h8,12,14-18H,1,9-11,13H2,2-7H3,(H,21,23) |
| InChIKey | AAPCDQKUZMGCMG-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.52 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|