C27H29N3O4 — CID 142752855
propan-2-yl N-[[7-[2-(4-methylphenyl)ethynyl]quinolin-8-yl]methyl]-N-(propan-2-yloxycarbonylamino)carbamate (PubChem CID 142752855) has the molecular formula C27H29N3O4 and a molecular weight of 459.55 g/mol. Its IUPAC name is propan-2-yl N-[[7-[2-(4-methylphenyl)ethynyl]quinolin-8-yl]methyl]-N-(propan-2-yloxycarbonylamino)carbamate.
| Compound Name | propan-2-yl N-[[7-[2-(4-methylphenyl)ethynyl]quinolin-8-yl]methyl]-N-(propan-2-yloxycarbonylamino)carbamate |
|---|---|
| PubChem CID | 142752855 |
| Molecular Formula | C27H29N3O4 |
| Molecular Weight | 459.55 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | propan-2-yl N-[[7-[2-(4-methylphenyl)ethynyl]quinolin-8-yl]methyl]-N-(propan-2-yloxycarbonylamino)carbamate |
| SMILES | Cc1ccc(C#Cc2ccc3cccnc3c2CN(NC(=O)OC(C)C)C(=O)OC(C)C)cc1 |
| InChI | InChI=1S/C27H29N3O4/c1-18(2)33-26(31)29-30(27(32)34-19(3)4)17-24-22(13-12-21-10-8-20(5)9-11-21)14-15-23-7-6-16-28-25(23)24/h6-11,14-16,18-19H,17H2,1-5H3,(H,29,31) |
| InChIKey | GLAFBTOBJGBPIK-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.55 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|