C38H42N6O9 — CID 118423558
methyl 2-[2-[bis(2-methoxy-2-oxoethyl)amino]ethyl-[2-[(2-methoxy-2-oxoethyl)-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetate (PubChem CID 118423558) has the molecular formula C38H42N6O9 and a molecular weight of 726.79 g/mol. Its IUPAC name is methyl 2-[2-[bis(2-methoxy-2-oxoethyl)amino]ethyl-[2-[(2-methoxy-2-oxoethyl)-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetate.
| Compound Name | methyl 2-[2-[bis(2-methoxy-2-oxoethyl)amino]ethyl-[2-[(2-methoxy-2-oxoethyl)-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetate |
|---|---|
| PubChem CID | 118423558 |
| Molecular Formula | C38H42N6O9 |
| Molecular Weight | 726.79 g/mol |
| Exact Mass | 726.30 |
| IUPAC Name | methyl 2-[2-[bis(2-methoxy-2-oxoethyl)amino]ethyl-[2-[(2-methoxy-2-oxoethyl)-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetate |
| SMILES | COC(=O)CN(CCN(CC(=O)Nc1ccc(C#Cc2ccc3ccc4cccnc4c3n2)cc1)CC(=O)OC)CCN(CC(=O)OC)CC(=O)OC |
| InChI | InChI=1S/C38H42N6O9/c1-50-33(46)23-42(19-21-44(25-35(48)52-3)26-36(49)53-4)18-20-43(24-34(47)51-2)22-32(45)40-30-13-7-27(8-14-30)9-15-31-16-12-29-11-10-28-6-5-17-39-37(28)38(29)41-31/h5-8,10-14,16-17H,18-26H2,1-4H3,(H,40,45) |
| InChIKey | HXFRZYURMXRKLK-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 169.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.79 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|