C35H38N6O9 — CID 161301211
2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetic acid;methane (PubChem CID 161301211) has the molecular formula C35H38N6O9 and a molecular weight of 686.72 g/mol. Its IUPAC name is 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetic acid;methane.
| Compound Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetic acid;methane |
|---|---|
| PubChem CID | 161301211 |
| Molecular Formula | C35H38N6O9 |
| Molecular Weight | 686.72 g/mol |
| Exact Mass | 686.27 |
| IUPAC Name | 2-[2-[bis(carboxymethyl)amino]ethyl-[2-[carboxymethyl-[2-oxo-2-[4-[2-(1,10-phenanthrolin-2-yl)ethynyl]anilino]ethyl]amino]ethyl]amino]acetic acid;methane |
| SMILES | C.O=C(O)CN(CCN(CC(=O)O)CC(=O)O)CCN(CC(=O)O)CC(=O)Nc1ccc(C#Cc2ccc3ccc4cccnc4c3n2)cc1 |
| InChI | InChI=1S/C34H34N6O9.CH4/c41-28(18-39(20-30(44)45)16-14-38(19-29(42)43)15-17-40(21-31(46)47)22-32(48)49)36-26-9-3-23(4-10-26)5-11-27-12-8-25-7-6-24-2-1-13-35-33(24)34(25)37-27;/h1-4,6-10,12-13H,14-22H2,(H,36,41)(H,42,43)(H,44,45)(H,46,47)(H,48,49);1H4 |
| InChIKey | VHQKRWIQQXHZOC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 213.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.72 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|