C24H37N3O5 — CID 139257076
tert-butyl N-[[2-(1-adamantyl)-1,3-oxazol-5-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate (PubChem CID 139257076) has the molecular formula C24H37N3O5 and a molecular weight of 447.58 g/mol. Its IUPAC name is tert-butyl N-[[2-(1-adamantyl)-1,3-oxazol-5-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate.
| Compound Name | tert-butyl N-[[2-(1-adamantyl)-1,3-oxazol-5-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
|---|---|
| PubChem CID | 139257076 |
| Molecular Formula | C24H37N3O5 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | tert-butyl N-[[2-(1-adamantyl)-1,3-oxazol-5-yl]methyl]-N-[(2-methylpropan-2-yl)oxycarbonylamino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN(Cc1cnc(C23CC4CC(CC(C4)C2)C3)o1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H37N3O5/c1-22(2,3)31-20(28)26-27(21(29)32-23(4,5)6)14-18-13-25-19(30-18)24-10-15-7-16(11-24)9-17(8-15)12-24/h13,15-17H,7-12,14H2,1-6H3,(H,26,28) |
| InChIKey | CICQATJLZJCHAP-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 93.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|