C19H20ClN3O2 — CID 118394246
2-(3-chloro-4-methoxyanilino)-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide (PubChem CID 118394246) has the molecular formula C19H20ClN3O2 and a molecular weight of 357.84 g/mol. Its IUPAC name is 2-(3-chloro-4-methoxyanilino)-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide.
| Compound Name | 2-(3-chloro-4-methoxyanilino)-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 118394246 |
| Molecular Formula | C19H20ClN3O2 |
| Molecular Weight | 357.84 g/mol |
| Exact Mass | 357.12 |
| IUPAC Name | 2-(3-chloro-4-methoxyanilino)-N-[(3R)-3-methylpent-1-yn-3-yl]pyridine-3-carboxamide |
| SMILES | C#C[C@@](C)(CC)NC(=O)c1cccnc1Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C19H20ClN3O2/c1-5-19(3,6-2)23-18(24)14-8-7-11-21-17(14)22-13-9-10-16(25-4)15(20)12-13/h1,7-12H,6H2,2-4H3,(H,21,22)(H,23,24)/t19-/m0/s1 |
| InChIKey | UIBLWLJTUPFGRC-IBGZPJMESA-N |
| XLogP | 4.02 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.84 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|