C23H13N3S — CID 118397435
2-(5-dibenzothiophen-2-yl-2-pyridinyl)pyridine-4-carbonitrile (PubChem CID 118397435) has the molecular formula C23H13N3S and a molecular weight of 363.45 g/mol. Its IUPAC name is 2-(5-dibenzothiophen-2-yl-2-pyridinyl)pyridine-4-carbonitrile.
| Compound Name | 2-(5-dibenzothiophen-2-yl-2-pyridinyl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 118397435 |
| Molecular Formula | C23H13N3S |
| Molecular Weight | 363.45 g/mol |
| Exact Mass | 363.08 |
| IUPAC Name | 2-(5-dibenzothiophen-2-yl-2-pyridinyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1ccnc(-c2ccc(-c3ccc4sc5ccccc5c4c3)cn2)c1 |
| InChI | InChI=1S/C23H13N3S/c24-13-15-9-10-25-21(11-15)20-7-5-17(14-26-20)16-6-8-23-19(12-16)18-3-1-2-4-22(18)27-23/h1-12,14H |
| InChIKey | YGLSYCPRHGBCSH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.45 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |