C26H23NO3 — CID 11839791
2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-8-phenylmethoxyquinoline (PubChem CID 11839791) has the molecular formula C26H23NO3 and a molecular weight of 397.47 g/mol. Its IUPAC name is 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-8-phenylmethoxyquinoline.
| Compound Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-8-phenylmethoxyquinoline |
|---|---|
| PubChem CID | 11839791 |
| Molecular Formula | C26H23NO3 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | 2-[(E)-2-(2,4-dimethoxyphenyl)ethenyl]-8-phenylmethoxyquinoline |
| SMILES | COc1ccc(/C=C/c2ccc3cccc(OCc4ccccc4)c3n2)c(OC)c1 |
| InChI | InChI=1S/C26H23NO3/c1-28-23-16-13-20(25(17-23)29-2)11-14-22-15-12-21-9-6-10-24(26(21)27-22)30-18-19-7-4-3-5-8-19/h3-17H,18H2,1-2H3/b14-11+ |
| InChIKey | ZDPKKTFLLASKFW-SDNWHVSQSA-N |
| XLogP | 6.00 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |