C22H28N6O3S — CID 118400230
(1R,2S,5R)-3-[[2-(cyclopropylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxyethyl)cyclopentane-1,2-diol (PubChem CID 118400230) has the molecular formula C22H28N6O3S and a molecular weight of 456.57 g/mol. Its IUPAC name is (1R,2S,5R)-3-[[2-(cyclopropylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxyethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,5R)-3-[[2-(cyclopropylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxyethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 118400230 |
| Molecular Formula | C22H28N6O3S |
| Molecular Weight | 456.57 g/mol |
| Exact Mass | 456.19 |
| IUPAC Name | (1R,2S,5R)-3-[[2-(cyclopropylamino)-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(2-hydroxyethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(NC2CC2)nc(NC2C[C@H](CCO)[C@@H](O)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C22H28N6O3S/c1-10-16(21-27-17-11(2)23-7-5-15(17)32-21)20(28-22(24-10)25-13-3-4-13)26-14-9-12(6-8-29)18(30)19(14)31/h5,7,12-14,18-19,29-31H,3-4,6,8-9H2,1-2H3,(H2,24,25,26,28)/t12-,14?,18+,19-/m0/s1 |
| InChIKey | RKTXACGWBDYYPM-LQCGCAQGSA-N |
| XLogP | 2.24 |
| TPSA | 136.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.57 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |