C18H22N6O3S — CID 46176356
(1R,2S,3R,5R)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol (PubChem CID 46176356) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is (1R,2S,3R,5R)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol.
| Compound Name | (1R,2S,3R,5R)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
|---|---|
| PubChem CID | 46176356 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | (1R,2S,3R,5R)-3-[[2-amino-6-methyl-5-(4-methyl-[1,3]thiazolo[4,5-c]pyridin-2-yl)pyrimidin-4-yl]amino]-5-(hydroxymethyl)cyclopentane-1,2-diol |
| SMILES | Cc1nc(N)nc(N[C@@H]2C[C@H](CO)[C@@H](O)[C@H]2O)c1-c1nc2c(C)nccc2s1 |
| InChI | InChI=1S/C18H22N6O3S/c1-7-12(17-23-13-8(2)20-4-3-11(13)28-17)16(24-18(19)21-7)22-10-5-9(6-25)14(26)15(10)27/h3-4,9-10,14-15,25-27H,5-6H2,1-2H3,(H3,19,21,22,24)/t9-,10-,14-,15+/m1/s1 |
| InChIKey | DGLNAWODOMCEFE-IDMWTJEOSA-N |
| XLogP | 0.86 |
| TPSA | 150.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |