C30H48O2 — CID 118403960
(2R,6aR,6bS,8aR,11R,12S,12aR,14bR)-2-hydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-one (PubChem CID 118403960) has the molecular formula C30H48O2 and a molecular weight of 440.71 g/mol. Its IUPAC name is (2R,6aR,6bS,8aR,11R,12S,12aR,14bR)-2-hydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-one.
| Compound Name | (2R,6aR,6bS,8aR,11R,12S,12aR,14bR)-2-hydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-one |
|---|---|
| PubChem CID | 118403960 |
| Molecular Formula | C30H48O2 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.37 |
| IUPAC Name | (2R,6aR,6bS,8aR,11R,12S,12aR,14bR)-2-hydroxy-4,4,6a,6b,8a,11,12,14b-octamethyl-1,2,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-one |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]3(C)C(=CCC4[C@@]5(C)C[C@@H](O)C(=O)C(C)(C)C5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C30H48O2/c1-18-11-13-27(5)15-16-29(7)20(24(27)19(18)2)9-10-23-28(6)17-21(31)25(32)26(3,4)22(28)12-14-30(23,29)8/h9,18-19,21-24,31H,10-17H2,1-8H3/t18-,19+,21-,22?,23?,24+,27-,28+,29-,30-/m1/s1 |
| InChIKey | IQEISUOAHIGTIG-UGPCWWKJSA-N |
| XLogP | 7.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|