C30H50N2O2 — CID 52916010
(3S,4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-4-amino-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-2-carboxamide (PubChem CID 52916010) has the molecular formula C30H50N2O2 and a molecular weight of 470.74 g/mol. Its IUPAC name is (3S,4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-4-amino-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-2-carboxamide.
| Compound Name | (3S,4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-4-amino-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-2-carboxamide |
|---|---|
| PubChem CID | 52916010 |
| Molecular Formula | C30H50N2O2 |
| Molecular Weight | 470.74 g/mol |
| Exact Mass | 470.39 |
| IUPAC Name | (3S,4R,4aR,6aR,6bS,8aR,11R,12S,12aR,14aR,14bR)-4-amino-3-hydroxy-4,6a,6b,8a,11,12,14b-heptamethyl-2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydro-1H-picene-2-carboxamide |
| SMILES | C[C@H]1[C@H](C)CC[C@]2(C)CC[C@]3(C)C(=CC[C@@H]4[C@@]5(C)CC(C(N)=O)[C@H](O)[C@](C)(N)[C@@H]5CC[C@]43C)[C@H]12 |
| InChI | InChI=1S/C30H50N2O2/c1-17-10-12-26(3)14-15-28(5)20(23(26)18(17)2)8-9-21-27(4)16-19(25(31)34)24(33)30(7,32)22(27)11-13-29(21,28)6/h8,17-19,21-24,33H,9-16,32H2,1-7H3,(H2,31,34)/t17-,18+,19?,21-,22-,23+,24+,26-,27-,28-,29-,30-/m1/s1 |
| InChIKey | UCNXWPQUGIZHMD-WEKRZANBSA-N |
| XLogP | 5.43 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.74 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|