C31H52O — CID 162903797
4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-ol (PubChem CID 162903797) has the molecular formula C31H52O and a molecular weight of 440.76 g/mol. Its IUPAC name is 4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-ol.
| Compound Name | 4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-ol |
|---|---|
| PubChem CID | 162903797 |
| Molecular Formula | C31H52O |
| Molecular Weight | 440.76 g/mol |
| Exact Mass | 440.40 |
| IUPAC Name | 4,4,4a,6a,6b,8a,11,12,14b-nonamethyl-1,2,3,5,6,7,8,9,10,11,12,12a,14,14a-tetradecahydropicen-3-ol |
| SMILES | CC1CCC2(C)CCC3(C)C(=CCC4C3(C)CCC3(C)C(C)(C)C(O)CCC43C)C2C1C |
| InChI | InChI=1S/C31H52O/c1-20-12-14-27(5)16-17-28(6)22(25(27)21(20)2)10-11-23-29(28,7)18-19-31(9)26(3,4)24(32)13-15-30(23,31)8/h10,20-21,23-25,32H,11-19H2,1-9H3 |
| InChIKey | HFUGNQUAKRXHNV-UHFFFAOYSA-N |
| XLogP | 8.41 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.76 |
| LogP ≤ 5 | 8.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|