C31H54O — CID 123827449
4-(1,5,6,8a,10a-pentamethyl-1-propyl-3,4b,5,6,7,8,9,10-octahydro-2H-phenanthren-2-yl)-2,2,4-trimethylcyclohexan-1-ol (PubChem CID 123827449) has the molecular formula C31H54O and a molecular weight of 442.77 g/mol. Its IUPAC name is 4-(1,5,6,8a,10a-pentamethyl-1-propyl-3,4b,5,6,7,8,9,10-octahydro-2H-phenanthren-2-yl)-2,2,4-trimethylcyclohexan-1-ol.
| Compound Name | 4-(1,5,6,8a,10a-pentamethyl-1-propyl-3,4b,5,6,7,8,9,10-octahydro-2H-phenanthren-2-yl)-2,2,4-trimethylcyclohexan-1-ol |
|---|---|
| PubChem CID | 123827449 |
| Molecular Formula | C31H54O |
| Molecular Weight | 442.77 g/mol |
| Exact Mass | 442.42 |
| IUPAC Name | 4-(1,5,6,8a,10a-pentamethyl-1-propyl-3,4b,5,6,7,8,9,10-octahydro-2H-phenanthren-2-yl)-2,2,4-trimethylcyclohexan-1-ol |
| SMILES | CCCC1(C)C(C2(C)CCC(O)C(C)(C)C2)CC=C2C3C(C)C(C)CCC3(C)CCC21C |
| InChI | InChI=1S/C31H54O/c1-10-15-31(9)24(29(7)17-14-25(32)27(4,5)20-29)12-11-23-26-22(3)21(2)13-16-28(26,6)18-19-30(23,31)8/h11,21-22,24-26,32H,10,12-20H2,1-9H3 |
| InChIKey | GAXOBMJIVQBOBA-UHFFFAOYSA-N |
| XLogP | 8.81 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.77 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|