C30H50O — CID 162979726
1,4,4,6a,6b,8a,11,12-octamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a,14b-hexadecahydropicen-3-ol (PubChem CID 162979726) has the molecular formula C30H50O and a molecular weight of 426.73 g/mol. Its IUPAC name is 1,4,4,6a,6b,8a,11,12-octamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a,14b-hexadecahydropicen-3-ol.
| Compound Name | 1,4,4,6a,6b,8a,11,12-octamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a,14b-hexadecahydropicen-3-ol |
|---|---|
| PubChem CID | 162979726 |
| Molecular Formula | C30H50O |
| Molecular Weight | 426.73 g/mol |
| Exact Mass | 426.39 |
| IUPAC Name | 1,4,4,6a,6b,8a,11,12-octamethyl-1,2,3,4a,5,6,7,8,9,10,11,12,12a,14,14a,14b-hexadecahydropicen-3-ol |
| SMILES | CC1CCC2(C)CCC3(C)C(=CCC4C5C(C)CC(O)C(C)(C)C5CCC43C)C2C1C |
| InChI | InChI=1S/C30H50O/c1-18-11-13-28(6)15-16-30(8)23(26(28)20(18)3)10-9-22-25-19(2)17-24(31)27(4,5)21(25)12-14-29(22,30)7/h10,18-22,24-26,31H,9,11-17H2,1-8H3 |
| InChIKey | MWVUTHMIFHYXNW-UHFFFAOYSA-N |
| XLogP | 7.88 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.73 |
| LogP ≤ 5 | 7.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|