C13H16N2O — CID 118407215
(2R,6R)-4-benzyl-6-methylmorpholine-2-carbonitrile (PubChem CID 118407215) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is (2R,6R)-4-benzyl-6-methylmorpholine-2-carbonitrile.
| Compound Name | (2R,6R)-4-benzyl-6-methylmorpholine-2-carbonitrile |
|---|---|
| PubChem CID | 118407215 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | (2R,6R)-4-benzyl-6-methylmorpholine-2-carbonitrile |
| SMILES | C[C@@H]1CN(Cc2ccccc2)C[C@H](C#N)O1 |
| InChI | InChI=1S/C13H16N2O/c1-11-8-15(10-13(7-14)16-11)9-12-5-3-2-4-6-12/h2-6,11,13H,8-10H2,1H3/t11-,13+/m1/s1 |
| InChIKey | CFPNZEFGACMFGY-YPMHNXCESA-N |
| XLogP | 1.80 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |