C22H30N2O — CID 118407524
2-(1,4-dibenzyl-6-methylpiperazin-2-yl)propan-2-ol (PubChem CID 118407524) has the molecular formula C22H30N2O and a molecular weight of 338.50 g/mol. Its IUPAC name is 2-(1,4-dibenzyl-6-methylpiperazin-2-yl)propan-2-ol.
| Compound Name | 2-(1,4-dibenzyl-6-methylpiperazin-2-yl)propan-2-ol |
|---|---|
| PubChem CID | 118407524 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 2-(1,4-dibenzyl-6-methylpiperazin-2-yl)propan-2-ol |
| SMILES | CC1CN(Cc2ccccc2)CC(C(C)(C)O)N1Cc1ccccc1 |
| InChI | InChI=1S/C22H30N2O/c1-18-14-23(15-19-10-6-4-7-11-19)17-21(22(2,3)25)24(18)16-20-12-8-5-9-13-20/h4-13,18,21,25H,14-17H2,1-3H3 |
| InChIKey | MOULWBYBBWUBNT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 26.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |