C16H18FNO2 — CID 118407952
2-ethyl-1-(2-fluoroethyl)-3-phenylmethoxypyridin-4-one (PubChem CID 118407952) has the molecular formula C16H18FNO2 and a molecular weight of 275.32 g/mol. Its IUPAC name is 2-ethyl-1-(2-fluoroethyl)-3-phenylmethoxypyridin-4-one.
| Compound Name | 2-ethyl-1-(2-fluoroethyl)-3-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 118407952 |
| Molecular Formula | C16H18FNO2 |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 2-ethyl-1-(2-fluoroethyl)-3-phenylmethoxypyridin-4-one |
| SMILES | CCc1c(OCc2ccccc2)c(=O)ccn1CCF |
| InChI | InChI=1S/C16H18FNO2/c1-2-14-16(15(19)8-10-18(14)11-9-17)20-12-13-6-4-3-5-7-13/h3-8,10H,2,9,11-12H2,1H3 |
| InChIKey | DOZDIFZDJZUATC-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |