C19H24N2O5 — CID 87289982
1-[1-(2-methoxyethyl)-4-oxo-3-phenylmethoxy-2-pyridinyl]propylcarbamic acid (PubChem CID 87289982) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is 1-[1-(2-methoxyethyl)-4-oxo-3-phenylmethoxy-2-pyridinyl]propylcarbamic acid.
| Compound Name | 1-[1-(2-methoxyethyl)-4-oxo-3-phenylmethoxy-2-pyridinyl]propylcarbamic acid |
|---|---|
| PubChem CID | 87289982 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | 1-[1-(2-methoxyethyl)-4-oxo-3-phenylmethoxy-2-pyridinyl]propylcarbamic acid |
| SMILES | CCC(NC(=O)O)c1c(OCc2ccccc2)c(=O)ccn1CCOC |
| InChI | InChI=1S/C19H24N2O5/c1-3-15(20-19(23)24)17-18(26-13-14-7-5-4-6-8-14)16(22)9-10-21(17)11-12-25-2/h4-10,15,20H,3,11-13H2,1-2H3,(H,23,24) |
| InChIKey | ZSUSAMWHFYPFOS-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |