C21H20ClNO4 — CID 21474316
2-[(4-chlorophenyl)-hydroxymethyl]-1-(2-hydroxyethyl)-3-phenylmethoxypyridin-4-one (PubChem CID 21474316) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-[(4-chlorophenyl)-hydroxymethyl]-1-(2-hydroxyethyl)-3-phenylmethoxypyridin-4-one.
| Compound Name | 2-[(4-chlorophenyl)-hydroxymethyl]-1-(2-hydroxyethyl)-3-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 21474316 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[(4-chlorophenyl)-hydroxymethyl]-1-(2-hydroxyethyl)-3-phenylmethoxypyridin-4-one |
| SMILES | O=c1ccn(CCO)c(C(O)c2ccc(Cl)cc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C21H20ClNO4/c22-17-8-6-16(7-9-17)20(26)19-21(18(25)10-11-23(19)12-13-24)27-14-15-4-2-1-3-5-15/h1-11,20,24,26H,12-14H2 |
| InChIKey | FFCYFCWKEVNDRK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |