C26H28N2O7 — CID 21474404
1-(2-hydroxyethyl)-2-[(4-nitrophenyl)-(oxan-2-yloxy)methyl]-3-phenylmethoxypyridin-4-one (PubChem CID 21474404) has the molecular formula C26H28N2O7 and a molecular weight of 480.52 g/mol. Its IUPAC name is 1-(2-hydroxyethyl)-2-[(4-nitrophenyl)-(oxan-2-yloxy)methyl]-3-phenylmethoxypyridin-4-one.
| Compound Name | 1-(2-hydroxyethyl)-2-[(4-nitrophenyl)-(oxan-2-yloxy)methyl]-3-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 21474404 |
| Molecular Formula | C26H28N2O7 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | 1-(2-hydroxyethyl)-2-[(4-nitrophenyl)-(oxan-2-yloxy)methyl]-3-phenylmethoxypyridin-4-one |
| SMILES | O=c1ccn(CCO)c(C(OC2CCCCO2)c2ccc([N+](=O)[O-])cc2)c1OCc1ccccc1 |
| InChI | InChI=1S/C26H28N2O7/c29-16-15-27-14-13-22(30)26(34-18-19-6-2-1-3-7-19)24(27)25(35-23-8-4-5-17-33-23)20-9-11-21(12-10-20)28(31)32/h1-3,6-7,9-14,23,25,29H,4-5,8,15-18H2 |
| InChIKey | FHOWKGFFKBRLTC-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 113.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|