C26H30N2O4 — CID 21474281
1-(2-aminoethyl)-2-[oxan-2-yloxy(phenyl)methyl]-3-phenylmethoxypyridin-4-one (PubChem CID 21474281) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is 1-(2-aminoethyl)-2-[oxan-2-yloxy(phenyl)methyl]-3-phenylmethoxypyridin-4-one.
| Compound Name | 1-(2-aminoethyl)-2-[oxan-2-yloxy(phenyl)methyl]-3-phenylmethoxypyridin-4-one |
|---|---|
| PubChem CID | 21474281 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | 1-(2-aminoethyl)-2-[oxan-2-yloxy(phenyl)methyl]-3-phenylmethoxypyridin-4-one |
| SMILES | NCCn1ccc(=O)c(OCc2ccccc2)c1C(OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C26H30N2O4/c27-15-17-28-16-14-22(29)26(31-19-20-9-3-1-4-10-20)24(28)25(21-11-5-2-6-12-21)32-23-13-7-8-18-30-23/h1-6,9-12,14,16,23,25H,7-8,13,15,17-19,27H2 |
| InChIKey | FKKLBOKXPOSONP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |