C28H32N2O5 — CID 21474374
N-[2-[2-[oxan-2-yloxy(phenyl)methyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]ethyl]acetamide (PubChem CID 21474374) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is N-[2-[2-[oxan-2-yloxy(phenyl)methyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]ethyl]acetamide.
| Compound Name | N-[2-[2-[oxan-2-yloxy(phenyl)methyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]ethyl]acetamide |
|---|---|
| PubChem CID | 21474374 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | N-[2-[2-[oxan-2-yloxy(phenyl)methyl]-4-oxo-3-phenylmethoxy-1-pyridinyl]ethyl]acetamide |
| SMILES | CC(=O)NCCn1ccc(=O)c(OCc2ccccc2)c1C(OC1CCCCO1)c1ccccc1 |
| InChI | InChI=1S/C28H32N2O5/c1-21(31)29-16-18-30-17-15-24(32)28(34-20-22-10-4-2-5-11-22)26(30)27(23-12-6-3-7-13-23)35-25-14-8-9-19-33-25/h2-7,10-13,15,17,25,27H,8-9,14,16,18-20H2,1H3,(H,29,31) |
| InChIKey | RMFWIROIYBEMFN-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |