C16H16N2O7 — CID 125354948
3-[(S)-(4-nitrophenyl)-[(2R)-oxan-2-yl]oxymethyl]-1,2-oxazole-4-carboxylic acid (PubChem CID 125354948) has the molecular formula C16H16N2O7 and a molecular weight of 348.31 g/mol. Its IUPAC name is 3-[(S)-(4-nitrophenyl)-[(2R)-oxan-2-yl]oxymethyl]-1,2-oxazole-4-carboxylic acid.
| Compound Name | 3-[(S)-(4-nitrophenyl)-[(2R)-oxan-2-yl]oxymethyl]-1,2-oxazole-4-carboxylic acid |
|---|---|
| PubChem CID | 125354948 |
| Molecular Formula | C16H16N2O7 |
| Molecular Weight | 348.31 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 3-[(S)-(4-nitrophenyl)-[(2R)-oxan-2-yl]oxymethyl]-1,2-oxazole-4-carboxylic acid |
| SMILES | O=C(O)c1conc1[C@@H](O[C@@H]1CCCCO1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C16H16N2O7/c19-16(20)12-9-24-17-14(12)15(25-13-3-1-2-8-23-13)10-4-6-11(7-5-10)18(21)22/h4-7,9,13,15H,1-3,8H2,(H,19,20)/t13-,15+/m1/s1 |
| InChIKey | FMMFUXMCEPVODC-HIFRSBDPSA-N |
| XLogP | 2.91 |
| TPSA | 124.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.31 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|