C19H20BrN3O2 — CID 118408649
tert-butyl N-[6-(bromomethyl)-2-phenylindazol-3-yl]carbamate (PubChem CID 118408649) has the molecular formula C19H20BrN3O2 and a molecular weight of 402.29 g/mol. Its IUPAC name is tert-butyl N-[6-(bromomethyl)-2-phenylindazol-3-yl]carbamate.
| Compound Name | tert-butyl N-[6-(bromomethyl)-2-phenylindazol-3-yl]carbamate |
|---|---|
| PubChem CID | 118408649 |
| Molecular Formula | C19H20BrN3O2 |
| Molecular Weight | 402.29 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | tert-butyl N-[6-(bromomethyl)-2-phenylindazol-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1c2ccc(CBr)cc2nn1-c1ccccc1 |
| InChI | InChI=1S/C19H20BrN3O2/c1-19(2,3)25-18(24)21-17-15-10-9-13(12-20)11-16(15)22-23(17)14-7-5-4-6-8-14/h4-11H,12H2,1-3H3,(H,21,24) |
| InChIKey | AARBJKVVKNGMFG-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.29 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|