C20H21N3O4 — CID 129021340
4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylindazole-6-carboxylic acid (PubChem CID 129021340) has the molecular formula C20H21N3O4 and a molecular weight of 367.41 g/mol. Its IUPAC name is 4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylindazole-6-carboxylic acid.
| Compound Name | 4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylindazole-6-carboxylic acid |
|---|---|
| PubChem CID | 129021340 |
| Molecular Formula | C20H21N3O4 |
| Molecular Weight | 367.41 g/mol |
| Exact Mass | 367.15 |
| IUPAC Name | 4-methyl-3-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylindazole-6-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)cc2nn(-c3ccccc3)c(NC(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C20H21N3O4/c1-12-10-13(18(24)25)11-15-16(12)17(21-19(26)27-20(2,3)4)23(22-15)14-8-6-5-7-9-14/h5-11H,1-4H3,(H,21,26)(H,24,25) |
| InChIKey | DFIFMVZINJJYPG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |