C26H23F3N8 — CID 118410204
N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 118410204) has the molecular formula C26H23F3N8 and a molecular weight of 504.52 g/mol. Its IUPAC name is N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118410204 |
| Molecular Formula | C26H23F3N8 |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.20 |
| IUPAC Name | N-[(1S,5R)-3-azabicyclo[3.1.0]hexan-6-yl]-5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Fc1cc(F)c(Nc2cc(-c3nc(NC4[C@H]5CNC[C@@H]45)c4c(C5CCC5)cncc4n3)ccn2)nc1F |
| InChI | InChI=1S/C26H23F3N8/c27-17-7-18(28)25(36-23(17)29)34-20-6-13(4-5-32-20)24-33-19-11-31-8-14(12-2-1-3-12)21(19)26(37-24)35-22-15-9-30-10-16(15)22/h4-8,11-12,15-16,22,30H,1-3,9-10H2,(H,32,34,36)(H,33,35,37)/t15-,16+,22? |
| InChIKey | LBSISVQFWSNBMV-XVQYUUQNSA-N |
| XLogP | 4.54 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|