C26H25F3N8O — CID 118410214
(3R,4R)-4-[[5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol (PubChem CID 118410214) has the molecular formula C26H25F3N8O and a molecular weight of 522.54 g/mol. Its IUPAC name is (3R,4R)-4-[[5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol.
| Compound Name | (3R,4R)-4-[[5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol |
|---|---|
| PubChem CID | 118410214 |
| Molecular Formula | C26H25F3N8O |
| Molecular Weight | 522.54 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | (3R,4R)-4-[[5-cyclobutyl-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-yl]amino]piperidin-3-ol |
| SMILES | O[C@@H]1CNCC[C@H]1Nc1nc(-c2ccnc(Nc3nc(F)c(F)cc3F)c2)nc2cncc(C3CCC3)c12 |
| InChI | InChI=1S/C26H25F3N8O/c27-16-9-17(28)25(36-23(16)29)35-21-8-14(4-7-32-21)24-34-19-11-31-10-15(13-2-1-3-13)22(19)26(37-24)33-18-5-6-30-12-20(18)38/h4,7-11,13,18,20,30,38H,1-3,5-6,12H2,(H,32,35,36)(H,33,34,37)/t18-,20-/m1/s1 |
| InChIKey | ZDWMIOVASQQCKW-UYAOXDASSA-N |
| XLogP | 4.04 |
| TPSA | 120.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.54 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|