C27H27F3N8O — CID 118410211
5-cyclobutyl-N-[(3R,4S)-3-methoxypiperidin-4-yl]-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine (PubChem CID 118410211) has the molecular formula C27H27F3N8O and a molecular weight of 536.56 g/mol. Its IUPAC name is 5-cyclobutyl-N-[(3R,4S)-3-methoxypiperidin-4-yl]-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | 5-cyclobutyl-N-[(3R,4S)-3-methoxypiperidin-4-yl]-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 118410211 |
| Molecular Formula | C27H27F3N8O |
| Molecular Weight | 536.56 g/mol |
| Exact Mass | 536.23 |
| IUPAC Name | 5-cyclobutyl-N-[(3R,4S)-3-methoxypiperidin-4-yl]-2-[2-[(3,5,6-trifluoro-2-pyridinyl)amino]-4-pyridinyl]pyrido[3,4-d]pyrimidin-4-amine |
| SMILES | CO[C@@H]1CNCC[C@@H]1Nc1nc(-c2ccnc(Nc3nc(F)c(F)cc3F)c2)nc2cncc(C3CCC3)c12 |
| InChI | InChI=1S/C27H27F3N8O/c1-39-21-13-31-7-6-19(21)34-27-23-16(14-3-2-4-14)11-32-12-20(23)35-25(38-27)15-5-8-33-22(9-15)36-26-18(29)10-17(28)24(30)37-26/h5,8-12,14,19,21,31H,2-4,6-7,13H2,1H3,(H,33,36,37)(H,34,35,38)/t19-,21+/m0/s1 |
| InChIKey | JBUKQVOEEFQAPI-PZJWPPBQSA-N |
| XLogP | 4.70 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.56 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|