C16H11F6NO3 — CID 118413748
[amino-[4-[3-(trifluoromethyl)phenoxy]phenyl]methyl] 2,2,2-trifluoroacetate (PubChem CID 118413748) has the molecular formula C16H11F6NO3 and a molecular weight of 379.26 g/mol. Its IUPAC name is [amino-[4-[3-(trifluoromethyl)phenoxy]phenyl]methyl] 2,2,2-trifluoroacetate.
| Compound Name | [amino-[4-[3-(trifluoromethyl)phenoxy]phenyl]methyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 118413748 |
| Molecular Formula | C16H11F6NO3 |
| Molecular Weight | 379.26 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [amino-[4-[3-(trifluoromethyl)phenoxy]phenyl]methyl] 2,2,2-trifluoroacetate |
| SMILES | NC(OC(=O)C(F)(F)F)c1ccc(Oc2cccc(C(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C16H11F6NO3/c17-15(18,19)10-2-1-3-12(8-10)25-11-6-4-9(5-7-11)13(23)26-14(24)16(20,21)22/h1-8,13H,23H2 |
| InChIKey | ONZURMLKYULNLK-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.26 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|