C15H14F3NO4S — CID 11302891
2-amino-2-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid (PubChem CID 11302891) has the molecular formula C15H14F3NO4S and a molecular weight of 361.34 g/mol. Its IUPAC name is 2-amino-2-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid.
| Compound Name | 2-amino-2-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid |
|---|---|
| PubChem CID | 11302891 |
| Molecular Formula | C15H14F3NO4S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.06 |
| IUPAC Name | 2-amino-2-[3-[3-(trifluoromethyl)phenoxy]phenyl]ethanesulfonic acid |
| SMILES | NC(CS(=O)(=O)O)c1cccc(Oc2cccc(C(F)(F)F)c2)c1 |
| InChI | InChI=1S/C15H14F3NO4S/c16-15(17,18)11-4-2-6-13(8-11)23-12-5-1-3-10(7-12)14(19)9-24(20,21)22/h1-8,14H,9,19H2,(H,20,21,22) |
| InChIKey | DUYGYQBBTBZGTF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|