C11H6F9NO2 — CID 118415347
methyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridine-2-carboxylate (PubChem CID 118415347) has the molecular formula C11H6F9NO2 and a molecular weight of 355.16 g/mol. Its IUPAC name is methyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridine-2-carboxylate.
| Compound Name | methyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 118415347 |
| Molecular Formula | C11H6F9NO2 |
| Molecular Weight | 355.16 g/mol |
| Exact Mass | 355.03 |
| IUPAC Name | methyl 3-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncccc1C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C11H6F9NO2/c1-23-7(22)6-5(3-2-4-21-6)8(12,13)9(14,15)10(16,17)11(18,19)20/h2-4H,1H3 |
| InChIKey | CACSSHUWHPBPEL-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.16 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|