C23H29F2N3O — CID 118415410
1-[3-(cyclobutylamino)propylamino]-3-(3,6-difluorocarbazol-9-yl)-2-methylpropan-2-ol (PubChem CID 118415410) has the molecular formula C23H29F2N3O and a molecular weight of 401.50 g/mol. Its IUPAC name is 1-[3-(cyclobutylamino)propylamino]-3-(3,6-difluorocarbazol-9-yl)-2-methylpropan-2-ol.
| Compound Name | 1-[3-(cyclobutylamino)propylamino]-3-(3,6-difluorocarbazol-9-yl)-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 118415410 |
| Molecular Formula | C23H29F2N3O |
| Molecular Weight | 401.50 g/mol |
| Exact Mass | 401.23 |
| IUPAC Name | 1-[3-(cyclobutylamino)propylamino]-3-(3,6-difluorocarbazol-9-yl)-2-methylpropan-2-ol |
| SMILES | CC(O)(CNCCCNC1CCC1)Cn1c2ccc(F)cc2c2cc(F)ccc21 |
| InChI | InChI=1S/C23H29F2N3O/c1-23(29,14-26-10-3-11-27-18-4-2-5-18)15-28-21-8-6-16(24)12-19(21)20-13-17(25)7-9-22(20)28/h6-9,12-13,18,26-27,29H,2-5,10-11,14-15H2,1H3 |
| InChIKey | PDBHLHRFDYOUJI-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.50 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|