C20H23FN2O3 — CID 118418350
ethyl 3-[4-(butylaminocarbamoyl)phenyl]-4-fluorobenzoate (PubChem CID 118418350) has the molecular formula C20H23FN2O3 and a molecular weight of 358.41 g/mol. Its IUPAC name is ethyl 3-[4-(butylaminocarbamoyl)phenyl]-4-fluorobenzoate.
| Compound Name | ethyl 3-[4-(butylaminocarbamoyl)phenyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 118418350 |
| Molecular Formula | C20H23FN2O3 |
| Molecular Weight | 358.41 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | ethyl 3-[4-(butylaminocarbamoyl)phenyl]-4-fluorobenzoate |
| SMILES | CCCCNNC(=O)c1ccc(-c2cc(C(=O)OCC)ccc2F)cc1 |
| InChI | InChI=1S/C20H23FN2O3/c1-3-5-12-22-23-19(24)15-8-6-14(7-9-15)17-13-16(10-11-18(17)21)20(25)26-4-2/h6-11,13,22H,3-5,12H2,1-2H3,(H,23,24) |
| InChIKey | YQCJXICGINBQLU-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.41 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|